C14H22ClN3O — CID 157430349
(4S)-1-(2-amino-6-chloro-4-pyridinyl)-4-(diethylamino)pentan-1-one (PubChem CID 157430349) has the molecular formula C14H22ClN3O and a molecular weight of 283.80 g/mol. Its IUPAC name is (4S)-1-(2-amino-6-chloro-4-pyridinyl)-4-(diethylamino)pentan-1-one.
| Compound Name | (4S)-1-(2-amino-6-chloro-4-pyridinyl)-4-(diethylamino)pentan-1-one |
|---|---|
| PubChem CID | 157430349 |
| Molecular Formula | C14H22ClN3O |
| Molecular Weight | 283.80 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | (4S)-1-(2-amino-6-chloro-4-pyridinyl)-4-(diethylamino)pentan-1-one |
| SMILES | CCN(CC)[C@@H](C)CCC(=O)c1cc(N)nc(Cl)c1 |
| InChI | InChI=1S/C14H22ClN3O/c1-4-18(5-2)10(3)6-7-12(19)11-8-13(15)17-14(16)9-11/h8-10H,4-7H2,1-3H3,(H2,16,17)/t10-/m0/s1 |
| InChIKey | STRHYNGBRALWDK-JTQLQIEISA-N |
| XLogP | 3.01 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.80 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|