C14H21ClN4O3 — CID 134540142
[6-chloro-4-[2-(diethylamino)propylcarbamoyl]-2-pyridinyl]carbamic acid (PubChem CID 134540142) has the molecular formula C14H21ClN4O3 and a molecular weight of 328.80 g/mol. Its IUPAC name is [6-chloro-4-[2-(diethylamino)propylcarbamoyl]-2-pyridinyl]carbamic acid.
| Compound Name | [6-chloro-4-[2-(diethylamino)propylcarbamoyl]-2-pyridinyl]carbamic acid |
|---|---|
| PubChem CID | 134540142 |
| Molecular Formula | C14H21ClN4O3 |
| Molecular Weight | 328.80 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | [6-chloro-4-[2-(diethylamino)propylcarbamoyl]-2-pyridinyl]carbamic acid |
| SMILES | CCN(CC)C(C)CNC(=O)c1cc(Cl)nc(NC(=O)O)c1 |
| InChI | InChI=1S/C14H21ClN4O3/c1-4-19(5-2)9(3)8-16-13(20)10-6-11(15)17-12(7-10)18-14(21)22/h6-7,9H,4-5,8H2,1-3H3,(H,16,20)(H,17,18)(H,21,22) |
| InChIKey | GZDSBUBWRMWMHW-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.80 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|