C16H20F6N2O — CID 52585751
N-[(2S)-2-(diethylamino)propyl]-3,5-bis(trifluoromethyl)benzamide (PubChem CID 52585751) has the molecular formula C16H20F6N2O and a molecular weight of 370.34 g/mol. Its IUPAC name is N-[(2S)-2-(diethylamino)propyl]-3,5-bis(trifluoromethyl)benzamide.
| Compound Name | N-[(2S)-2-(diethylamino)propyl]-3,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 52585751 |
| Molecular Formula | C16H20F6N2O |
| Molecular Weight | 370.34 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | N-[(2S)-2-(diethylamino)propyl]-3,5-bis(trifluoromethyl)benzamide |
| SMILES | CCN(CC)[C@@H](C)CNC(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H20F6N2O/c1-4-24(5-2)10(3)9-23-14(25)11-6-12(15(17,18)19)8-13(7-11)16(20,21)22/h6-8,10H,4-5,9H2,1-3H3,(H,23,25)/t10-/m0/s1 |
| InChIKey | BTVSIMFTNFWNNK-JTQLQIEISA-N |
| XLogP | 4.18 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.34 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |