C20H26F6N2O3 — CID 122549183
tert-butyl N-[(4R)-5-[[3,5-bis(trifluoromethyl)benzoyl]amino]-4-methylpentyl]carbamate (PubChem CID 122549183) has the molecular formula C20H26F6N2O3 and a molecular weight of 456.43 g/mol. Its IUPAC name is tert-butyl N-[(4R)-5-[[3,5-bis(trifluoromethyl)benzoyl]amino]-4-methylpentyl]carbamate.
| Compound Name | tert-butyl N-[(4R)-5-[[3,5-bis(trifluoromethyl)benzoyl]amino]-4-methylpentyl]carbamate |
|---|---|
| PubChem CID | 122549183 |
| Molecular Formula | C20H26F6N2O3 |
| Molecular Weight | 456.43 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | tert-butyl N-[(4R)-5-[[3,5-bis(trifluoromethyl)benzoyl]amino]-4-methylpentyl]carbamate |
| SMILES | C[C@H](CCCNC(=O)OC(C)(C)C)CNC(=O)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H26F6N2O3/c1-12(6-5-7-27-17(30)31-18(2,3)4)11-28-16(29)13-8-14(19(21,22)23)10-15(9-13)20(24,25)26/h8-10,12H,5-7,11H2,1-4H3,(H,27,30)(H,28,29)/t12-/m1/s1 |
| InChIKey | DHKJQQDHNVMIEI-GFCCVEGCSA-N |
| XLogP | 5.39 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.43 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|