C27H32F6N2O7S — CID 89150408
2-[3,5-bis(trifluoromethyl)phenoxy]ethyl 3-[5-[(2-methylpropan-2-yl)oxycarbonylamino]pentylcarbamoyl]benzenesulfonate (PubChem CID 89150408) has the molecular formula C27H32F6N2O7S and a molecular weight of 642.62 g/mol. Its IUPAC name is 2-[3,5-bis(trifluoromethyl)phenoxy]ethyl 3-[5-[(2-methylpropan-2-yl)oxycarbonylamino]pentylcarbamoyl]benzenesulfonate.
| Compound Name | 2-[3,5-bis(trifluoromethyl)phenoxy]ethyl 3-[5-[(2-methylpropan-2-yl)oxycarbonylamino]pentylcarbamoyl]benzenesulfonate |
|---|---|
| PubChem CID | 89150408 |
| Molecular Formula | C27H32F6N2O7S |
| Molecular Weight | 642.62 g/mol |
| Exact Mass | 642.18 |
| IUPAC Name | 2-[3,5-bis(trifluoromethyl)phenoxy]ethyl 3-[5-[(2-methylpropan-2-yl)oxycarbonylamino]pentylcarbamoyl]benzenesulfonate |
| SMILES | CC(C)(C)OC(=O)NCCCCCNC(=O)c1cccc(S(=O)(=O)OCCOc2cc(C(F)(F)F)cc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C27H32F6N2O7S/c1-25(2,3)42-24(37)35-11-6-4-5-10-34-23(36)18-8-7-9-22(14-18)43(38,39)41-13-12-40-21-16-19(26(28,29)30)15-20(17-21)27(31,32)33/h7-9,14-17H,4-6,10-13H2,1-3H3,(H,34,36)(H,35,37) |
| InChIKey | IHKADFZLPYNZLZ-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.62 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|