C30H39F6N3O8S — CID 162600662
2-[2-[[3,5-bis(trifluoromethyl)benzoyl]amino]ethoxy]ethyl 3-[hydroxy-[5-[(2-methylpropan-2-yl)oxycarbonylamino]pentylamino]methyl]benzenesulfonate (PubChem CID 162600662) has the molecular formula C30H39F6N3O8S and a molecular weight of 715.71 g/mol. Its IUPAC name is 2-[2-[[3,5-bis(trifluoromethyl)benzoyl]amino]ethoxy]ethyl 3-[hydroxy-[5-[(2-methylpropan-2-yl)oxycarbonylamino]pentylamino]methyl]benzenesulfonate.
| Compound Name | 2-[2-[[3,5-bis(trifluoromethyl)benzoyl]amino]ethoxy]ethyl 3-[hydroxy-[5-[(2-methylpropan-2-yl)oxycarbonylamino]pentylamino]methyl]benzenesulfonate |
|---|---|
| PubChem CID | 162600662 |
| Molecular Formula | C30H39F6N3O8S |
| Molecular Weight | 715.71 g/mol |
| Exact Mass | 715.24 |
| IUPAC Name | 2-[2-[[3,5-bis(trifluoromethyl)benzoyl]amino]ethoxy]ethyl 3-[hydroxy-[5-[(2-methylpropan-2-yl)oxycarbonylamino]pentylamino]methyl]benzenesulfonate |
| SMILES | CC(C)(C)OC(=O)NCCCCCNC(O)c1cccc(S(=O)(=O)OCCOCCNC(=O)c2cc(C(F)(F)F)cc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C30H39F6N3O8S/c1-28(2,3)47-27(42)39-11-6-4-5-10-37-25(40)20-8-7-9-24(18-20)48(43,44)46-15-14-45-13-12-38-26(41)21-16-22(29(31,32)33)19-23(17-21)30(34,35)36/h7-9,16-19,25,37,40H,4-6,10-15H2,1-3H3,(H,38,41)(H,39,42) |
| InChIKey | KFCZMSOZZUUZQY-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 152.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.71 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|