C19H31NO2 — CID 141127480
3,5-ditert-butyl-N-(3-hydroxy-2-methylpropyl)benzamide (PubChem CID 141127480) has the molecular formula C19H31NO2 and a molecular weight of 305.46 g/mol. Its IUPAC name is 3,5-ditert-butyl-N-(3-hydroxy-2-methylpropyl)benzamide.
| Compound Name | 3,5-ditert-butyl-N-(3-hydroxy-2-methylpropyl)benzamide |
|---|---|
| PubChem CID | 141127480 |
| Molecular Formula | C19H31NO2 |
| Molecular Weight | 305.46 g/mol |
| Exact Mass | 305.24 |
| IUPAC Name | 3,5-ditert-butyl-N-(3-hydroxy-2-methylpropyl)benzamide |
| SMILES | CC(CO)CNC(=O)c1cc(C(C)(C)C)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C19H31NO2/c1-13(12-21)11-20-17(22)14-8-15(18(2,3)4)10-16(9-14)19(5,6)7/h8-10,13,21H,11-12H2,1-7H3,(H,20,22) |
| InChIKey | CLABRHGAXHCHOK-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.46 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |