C15H21F3N2O2 — CID 103387055
tert-butyl N-[2-[3-(trifluoromethyl)anilino]propyl]carbamate (PubChem CID 103387055) has the molecular formula C15H21F3N2O2 and a molecular weight of 318.34 g/mol. Its IUPAC name is tert-butyl N-[2-[3-(trifluoromethyl)anilino]propyl]carbamate.
| Compound Name | tert-butyl N-[2-[3-(trifluoromethyl)anilino]propyl]carbamate |
|---|---|
| PubChem CID | 103387055 |
| Molecular Formula | C15H21F3N2O2 |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | tert-butyl N-[2-[3-(trifluoromethyl)anilino]propyl]carbamate |
| SMILES | CC(CNC(=O)OC(C)(C)C)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H21F3N2O2/c1-10(9-19-13(21)22-14(2,3)4)20-12-7-5-6-11(8-12)15(16,17)18/h5-8,10,20H,9H2,1-4H3,(H,19,21) |
| InChIKey | PBFNSORMZWHRNN-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |