C26H32FN3O3 — CID 159505362
tert-butyl N-[(4R)-5-[[5-(4-fluorophenyl)-1H-indole-2-carbonyl]amino]-4-methylpentyl]carbamate (PubChem CID 159505362) has the molecular formula C26H32FN3O3 and a molecular weight of 453.56 g/mol. Its IUPAC name is tert-butyl N-[(4R)-5-[[5-(4-fluorophenyl)-1H-indole-2-carbonyl]amino]-4-methylpentyl]carbamate.
| Compound Name | tert-butyl N-[(4R)-5-[[5-(4-fluorophenyl)-1H-indole-2-carbonyl]amino]-4-methylpentyl]carbamate |
|---|---|
| PubChem CID | 159505362 |
| Molecular Formula | C26H32FN3O3 |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.24 |
| IUPAC Name | tert-butyl N-[(4R)-5-[[5-(4-fluorophenyl)-1H-indole-2-carbonyl]amino]-4-methylpentyl]carbamate |
| SMILES | C[C@H](CCCNC(=O)OC(C)(C)C)CNC(=O)c1cc2cc(-c3ccc(F)cc3)ccc2[nH]1 |
| InChI | InChI=1S/C26H32FN3O3/c1-17(6-5-13-28-25(32)33-26(2,3)4)16-29-24(31)23-15-20-14-19(9-12-22(20)30-23)18-7-10-21(27)11-8-18/h7-12,14-15,17,30H,5-6,13,16H2,1-4H3,(H,28,32)(H,29,31)/t17-/m1/s1 |
| InChIKey | QQHCVJAZZHSOAC-QGZVFWFLSA-N |
| XLogP | 5.64 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|