C15H17FN2O3 — CID 37254903
ethyl 4-[(5-fluoro-1H-indole-2-carbonyl)amino]butanoate (PubChem CID 37254903) has the molecular formula C15H17FN2O3 and a molecular weight of 292.31 g/mol. Its IUPAC name is ethyl 4-[(5-fluoro-1H-indole-2-carbonyl)amino]butanoate.
| Compound Name | ethyl 4-[(5-fluoro-1H-indole-2-carbonyl)amino]butanoate |
|---|---|
| PubChem CID | 37254903 |
| Molecular Formula | C15H17FN2O3 |
| Molecular Weight | 292.31 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | ethyl 4-[(5-fluoro-1H-indole-2-carbonyl)amino]butanoate |
| SMILES | CCOC(=O)CCCNC(=O)c1cc2cc(F)ccc2[nH]1 |
| InChI | InChI=1S/C15H17FN2O3/c1-2-21-14(19)4-3-7-17-15(20)13-9-10-8-11(16)5-6-12(10)18-13/h5-6,8-9,18H,2-4,7H2,1H3,(H,17,20) |
| InChIKey | SCNAVCHOTXTAJA-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.31 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|