C22H30N4O5 — CID 10574660
ethyl 5-[[5-[(E)-N'-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-1H-indole-2-carbonyl]amino]pentanoate (PubChem CID 10574660) has the molecular formula C22H30N4O5 and a molecular weight of 430.51 g/mol. Its IUPAC name is ethyl 5-[[5-[(E)-N'-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-1H-indole-2-carbonyl]amino]pentanoate.
| Compound Name | ethyl 5-[[5-[(E)-N'-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-1H-indole-2-carbonyl]amino]pentanoate |
|---|---|
| PubChem CID | 10574660 |
| Molecular Formula | C22H30N4O5 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | ethyl 5-[[5-[(E)-N'-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-1H-indole-2-carbonyl]amino]pentanoate |
| SMILES | CCOC(=O)CCCCNC(=O)c1cc2cc(/C(N)=N\C(=O)OC(C)(C)C)ccc2[nH]1 |
| InChI | InChI=1S/C22H30N4O5/c1-5-30-18(27)8-6-7-11-24-20(28)17-13-15-12-14(9-10-16(15)25-17)19(23)26-21(29)31-22(2,3)4/h9-10,12-13,25H,5-8,11H2,1-4H3,(H,24,28)(H2,23,26,29) |
| InChIKey | TUTWVNIFHMUFTQ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 135.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|