C23H33N3O3S — CID 10741349
tert-butyl 7-[(5-carbamothioyl-1H-indole-2-carbonyl)amino]-3-ethylheptanoate (PubChem CID 10741349) has the molecular formula C23H33N3O3S and a molecular weight of 431.60 g/mol. Its IUPAC name is tert-butyl 7-[(5-carbamothioyl-1H-indole-2-carbonyl)amino]-3-ethylheptanoate.
| Compound Name | tert-butyl 7-[(5-carbamothioyl-1H-indole-2-carbonyl)amino]-3-ethylheptanoate |
|---|---|
| PubChem CID | 10741349 |
| Molecular Formula | C23H33N3O3S |
| Molecular Weight | 431.60 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | tert-butyl 7-[(5-carbamothioyl-1H-indole-2-carbonyl)amino]-3-ethylheptanoate |
| SMILES | CCC(CCCCNC(=O)c1cc2cc(C(N)=S)ccc2[nH]1)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H33N3O3S/c1-5-15(12-20(27)29-23(2,3)4)8-6-7-11-25-22(28)19-14-17-13-16(21(24)30)9-10-18(17)26-19/h9-10,13-15,26H,5-8,11-12H2,1-4H3,(H2,24,30)(H,25,28) |
| InChIKey | GYKVREVNXLFEPL-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 97.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.60 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|