C22H23N3O3S — CID 10811487
ethyl 3-[4-[[(5-carbamothioyl-1H-indole-2-carbonyl)amino]methyl]phenyl]propanoate (PubChem CID 10811487) has the molecular formula C22H23N3O3S and a molecular weight of 409.51 g/mol. Its IUPAC name is ethyl 3-[4-[[(5-carbamothioyl-1H-indole-2-carbonyl)amino]methyl]phenyl]propanoate.
| Compound Name | ethyl 3-[4-[[(5-carbamothioyl-1H-indole-2-carbonyl)amino]methyl]phenyl]propanoate |
|---|---|
| PubChem CID | 10811487 |
| Molecular Formula | C22H23N3O3S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | ethyl 3-[4-[[(5-carbamothioyl-1H-indole-2-carbonyl)amino]methyl]phenyl]propanoate |
| SMILES | CCOC(=O)CCc1ccc(CNC(=O)c2cc3cc(C(N)=S)ccc3[nH]2)cc1 |
| InChI | InChI=1S/C22H23N3O3S/c1-2-28-20(26)10-7-14-3-5-15(6-4-14)13-24-22(27)19-12-17-11-16(21(23)29)8-9-18(17)25-19/h3-6,8-9,11-12,25H,2,7,10,13H2,1H3,(H2,23,29)(H,24,27) |
| InChIKey | RRATVBMFUFIYEZ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 97.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|