C27H32N4O5 — CID 23228296
ethyl 3-[4-[[[5-[(Z)-N'-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-1H-indole-2-carbonyl]amino]methyl]phenyl]propanoate (PubChem CID 23228296) has the molecular formula C27H32N4O5 and a molecular weight of 492.58 g/mol. Its IUPAC name is ethyl 3-[4-[[[5-[(Z)-N'-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-1H-indole-2-carbonyl]amino]methyl]phenyl]propanoate.
| Compound Name | ethyl 3-[4-[[[5-[(Z)-N'-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-1H-indole-2-carbonyl]amino]methyl]phenyl]propanoate |
|---|---|
| PubChem CID | 23228296 |
| Molecular Formula | C27H32N4O5 |
| Molecular Weight | 492.58 g/mol |
| Exact Mass | 492.24 |
| IUPAC Name | ethyl 3-[4-[[[5-[(Z)-N'-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-1H-indole-2-carbonyl]amino]methyl]phenyl]propanoate |
| SMILES | CCOC(=O)CCc1ccc(CNC(=O)c2cc3cc(/C(N)=N/C(=O)OC(C)(C)C)ccc3[nH]2)cc1 |
| InChI | InChI=1S/C27H32N4O5/c1-5-35-23(32)13-10-17-6-8-18(9-7-17)16-29-25(33)22-15-20-14-19(11-12-21(20)30-22)24(28)31-26(34)36-27(2,3)4/h6-9,11-12,14-15,30H,5,10,13,16H2,1-4H3,(H,29,33)(H2,28,31,34) |
| InChIKey | YOPKUTHPOQIHGW-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 135.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.58 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|