C26H38N4O5 — CID 22953222
2-butyl-7-[[5-[(Z)-N'-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-1H-indole-2-carbonyl]amino]heptanoic acid (PubChem CID 22953222) has the molecular formula C26H38N4O5 and a molecular weight of 486.61 g/mol. Its IUPAC name is 2-butyl-7-[[5-[(Z)-N'-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-1H-indole-2-carbonyl]amino]heptanoic acid.
| Compound Name | 2-butyl-7-[[5-[(Z)-N'-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-1H-indole-2-carbonyl]amino]heptanoic acid |
|---|---|
| PubChem CID | 22953222 |
| Molecular Formula | C26H38N4O5 |
| Molecular Weight | 486.61 g/mol |
| Exact Mass | 486.28 |
| IUPAC Name | 2-butyl-7-[[5-[(Z)-N'-[(2-methylpropan-2-yl)oxycarbonyl]carbamimidoyl]-1H-indole-2-carbonyl]amino]heptanoic acid |
| SMILES | CCCCC(CCCCCNC(=O)c1cc2cc(/C(N)=N/C(=O)OC(C)(C)C)ccc2[nH]1)C(=O)O |
| InChI | InChI=1S/C26H38N4O5/c1-5-6-10-17(24(32)33)11-8-7-9-14-28-23(31)21-16-19-15-18(12-13-20(19)29-21)22(27)30-25(34)35-26(2,3)4/h12-13,15-17,29H,5-11,14H2,1-4H3,(H,28,31)(H,32,33)(H2,27,30,34) |
| InChIKey | WGKXCBDABJMGED-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 146.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.61 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|