C20H26N4O4 — CID 42568817
ethyl 4-[4-(1H-indole-2-carbonylamino)butanoyl]piperazine-1-carboxylate (PubChem CID 42568817) has the molecular formula C20H26N4O4 and a molecular weight of 386.45 g/mol. Its IUPAC name is ethyl 4-[4-(1H-indole-2-carbonylamino)butanoyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[4-(1H-indole-2-carbonylamino)butanoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 42568817 |
| Molecular Formula | C20H26N4O4 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | ethyl 4-[4-(1H-indole-2-carbonylamino)butanoyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)CCCNC(=O)c2cc3ccccc3[nH]2)CC1 |
| InChI | InChI=1S/C20H26N4O4/c1-2-28-20(27)24-12-10-23(11-13-24)18(25)8-5-9-21-19(26)17-14-15-6-3-4-7-16(15)22-17/h3-4,6-7,14,22H,2,5,8-13H2,1H3,(H,21,26) |
| InChIKey | XDAYYPHSLIWADS-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 94.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|