C24H27N3O3 — CID 86938809
N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]-6-ethoxy-1H-indole-2-carboxamide (PubChem CID 86938809) has the molecular formula C24H27N3O3 and a molecular weight of 405.50 g/mol. Its IUPAC name is N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]-6-ethoxy-1H-indole-2-carboxamide.
| Compound Name | N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]-6-ethoxy-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 86938809 |
| Molecular Formula | C24H27N3O3 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.21 |
| IUPAC Name | N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]-6-ethoxy-1H-indole-2-carboxamide |
| SMILES | CCOc1ccc2cc(C(=O)NCCCC(=O)N3CCc4ccccc4C3)[nH]c2c1 |
| InChI | InChI=1S/C24H27N3O3/c1-2-30-20-10-9-18-14-22(26-21(18)15-20)24(29)25-12-5-8-23(28)27-13-11-17-6-3-4-7-19(17)16-27/h3-4,6-7,9-10,14-15,26H,2,5,8,11-13,16H2,1H3,(H,25,29) |
| InChIKey | PBXCHZPJUCKTJZ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 74.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|