C26H28N2O3S — CID 86938583
N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]-4-(4-methoxyphenyl)-5-methylthiophene-2-carboxamide (PubChem CID 86938583) has the molecular formula C26H28N2O3S and a molecular weight of 448.59 g/mol. Its IUPAC name is N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]-4-(4-methoxyphenyl)-5-methylthiophene-2-carboxamide.
| Compound Name | N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]-4-(4-methoxyphenyl)-5-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 86938583 |
| Molecular Formula | C26H28N2O3S |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]-4-(4-methoxyphenyl)-5-methylthiophene-2-carboxamide |
| SMILES | COc1ccc(-c2cc(C(=O)NCCCC(=O)N3CCc4ccccc4C3)sc2C)cc1 |
| InChI | InChI=1S/C26H28N2O3S/c1-18-23(20-9-11-22(31-2)12-10-20)16-24(32-18)26(30)27-14-5-8-25(29)28-15-13-19-6-3-4-7-21(19)17-28/h3-4,6-7,9-12,16H,5,8,13-15,17H2,1-2H3,(H,27,30) |
| InChIKey | OWHBRAOZLQJLKF-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|