C23H23FN2O2S — CID 86938826
N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]-4-fluoro-3-methyl-1-benzothiophene-2-carboxamide (PubChem CID 86938826) has the molecular formula C23H23FN2O2S and a molecular weight of 410.51 g/mol. Its IUPAC name is N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]-4-fluoro-3-methyl-1-benzothiophene-2-carboxamide.
| Compound Name | N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]-4-fluoro-3-methyl-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 86938826 |
| Molecular Formula | C23H23FN2O2S |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | N-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]-4-fluoro-3-methyl-1-benzothiophene-2-carboxamide |
| SMILES | Cc1c(C(=O)NCCCC(=O)N2CCc3ccccc3C2)sc2cccc(F)c12 |
| InChI | InChI=1S/C23H23FN2O2S/c1-15-21-18(24)8-4-9-19(21)29-22(15)23(28)25-12-5-10-20(27)26-13-11-16-6-2-3-7-17(16)14-26/h2-4,6-9H,5,10-14H2,1H3,(H,25,28) |
| InChIKey | XRGHOZYPBBTIAH-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|