C18H20N4O4 — CID 10618238
ethyl 2-[4-[(5-cyano-1H-indole-2-carbonyl)amino]butanoylamino]acetate (PubChem CID 10618238) has the molecular formula C18H20N4O4 and a molecular weight of 356.38 g/mol. Its IUPAC name is ethyl 2-[4-[(5-cyano-1H-indole-2-carbonyl)amino]butanoylamino]acetate.
| Compound Name | ethyl 2-[4-[(5-cyano-1H-indole-2-carbonyl)amino]butanoylamino]acetate |
|---|---|
| PubChem CID | 10618238 |
| Molecular Formula | C18H20N4O4 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | ethyl 2-[4-[(5-cyano-1H-indole-2-carbonyl)amino]butanoylamino]acetate |
| SMILES | CCOC(=O)CNC(=O)CCCNC(=O)c1cc2cc(C#N)ccc2[nH]1 |
| InChI | InChI=1S/C18H20N4O4/c1-2-26-17(24)11-21-16(23)4-3-7-20-18(25)15-9-13-8-12(10-19)5-6-14(13)22-15/h5-6,8-9,22H,2-4,7,11H2,1H3,(H,20,25)(H,21,23) |
| InChIKey | VQWHDSSTSJSHAQ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 124.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|