C23H25FN4O5 — CID 135324977
[6-(carboxyamino)-2-[[6-(4-fluorophenyl)-1H-indole-2-carbonyl]amino]hexan-3-yl]carbamic acid (PubChem CID 135324977) has the molecular formula C23H25FN4O5 and a molecular weight of 456.47 g/mol. Its IUPAC name is [6-(carboxyamino)-2-[[6-(4-fluorophenyl)-1H-indole-2-carbonyl]amino]hexan-3-yl]carbamic acid.
| Compound Name | [6-(carboxyamino)-2-[[6-(4-fluorophenyl)-1H-indole-2-carbonyl]amino]hexan-3-yl]carbamic acid |
|---|---|
| PubChem CID | 135324977 |
| Molecular Formula | C23H25FN4O5 |
| Molecular Weight | 456.47 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | [6-(carboxyamino)-2-[[6-(4-fluorophenyl)-1H-indole-2-carbonyl]amino]hexan-3-yl]carbamic acid |
| SMILES | CC(NC(=O)c1cc2ccc(-c3ccc(F)cc3)cc2[nH]1)C(CCCNC(=O)O)NC(=O)O |
| InChI | InChI=1S/C23H25FN4O5/c1-13(18(28-23(32)33)3-2-10-25-22(30)31)26-21(29)20-12-16-5-4-15(11-19(16)27-20)14-6-8-17(24)9-7-14/h4-9,11-13,18,25,27-28H,2-3,10H2,1H3,(H,26,29)(H,30,31)(H,32,33) |
| InChIKey | OPQUDMGPORTJSC-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 143.55 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.47 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|