C14H15FN2O3 — CID 16677025
ethyl 2-[(6-fluoro-1H-indole-2-carbonyl)amino]propanoate (PubChem CID 16677025) has the molecular formula C14H15FN2O3 and a molecular weight of 278.28 g/mol. Its IUPAC name is ethyl 2-[(6-fluoro-1H-indole-2-carbonyl)amino]propanoate.
| Compound Name | ethyl 2-[(6-fluoro-1H-indole-2-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 16677025 |
| Molecular Formula | C14H15FN2O3 |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | ethyl 2-[(6-fluoro-1H-indole-2-carbonyl)amino]propanoate |
| SMILES | CCOC(=O)C(C)NC(=O)c1cc2ccc(F)cc2[nH]1 |
| InChI | InChI=1S/C14H15FN2O3/c1-3-20-14(19)8(2)16-13(18)12-6-9-4-5-10(15)7-11(9)17-12/h4-8,17H,3H2,1-2H3,(H,16,18) |
| InChIKey | LVPMVZYXMJMIDZ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |