C21H17FN4O — CID 151951735
N-[(4-amino-2-pyridinyl)methyl]-6-(4-fluorophenyl)-1H-indole-2-carboxamide (PubChem CID 151951735) has the molecular formula C21H17FN4O and a molecular weight of 360.39 g/mol. Its IUPAC name is N-[(4-amino-2-pyridinyl)methyl]-6-(4-fluorophenyl)-1H-indole-2-carboxamide.
| Compound Name | N-[(4-amino-2-pyridinyl)methyl]-6-(4-fluorophenyl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 151951735 |
| Molecular Formula | C21H17FN4O |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | N-[(4-amino-2-pyridinyl)methyl]-6-(4-fluorophenyl)-1H-indole-2-carboxamide |
| SMILES | Nc1ccnc(CNC(=O)c2cc3ccc(-c4ccc(F)cc4)cc3[nH]2)c1 |
| InChI | InChI=1S/C21H17FN4O/c22-16-5-3-13(4-6-16)14-1-2-15-10-20(26-19(15)9-14)21(27)25-12-18-11-17(23)7-8-24-18/h1-11,26H,12H2,(H2,23,24)(H,25,27) |
| InChIKey | TWUKFNZYUFZWGD-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |