C23H27FN4O — CID 135324289
N-[2-[(3-aminocyclohexyl)amino]ethyl]-6-(4-fluorophenyl)-1H-indole-2-carboxamide (PubChem CID 135324289) has the molecular formula C23H27FN4O and a molecular weight of 394.49 g/mol. Its IUPAC name is N-[2-[(3-aminocyclohexyl)amino]ethyl]-6-(4-fluorophenyl)-1H-indole-2-carboxamide.
| Compound Name | N-[2-[(3-aminocyclohexyl)amino]ethyl]-6-(4-fluorophenyl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 135324289 |
| Molecular Formula | C23H27FN4O |
| Molecular Weight | 394.49 g/mol |
| Exact Mass | 394.22 |
| IUPAC Name | N-[2-[(3-aminocyclohexyl)amino]ethyl]-6-(4-fluorophenyl)-1H-indole-2-carboxamide |
| SMILES | NC1CCCC(NCCNC(=O)c2cc3ccc(-c4ccc(F)cc4)cc3[nH]2)C1 |
| InChI | InChI=1S/C23H27FN4O/c24-18-8-6-15(7-9-18)16-4-5-17-13-22(28-21(17)12-16)23(29)27-11-10-26-20-3-1-2-19(25)14-20/h4-9,12-13,19-20,26,28H,1-3,10-11,14,25H2,(H,27,29) |
| InChIKey | SRWVLKIZKPYJOT-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 82.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.49 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|