C21H24ClFN4O — CID 135324452
6-(4-fluorophenyl)-N-[2-(pyrrolidin-3-ylamino)ethyl]-1H-indole-2-carboxamide;hydron;chloride (PubChem CID 135324452) has the molecular formula C21H24ClFN4O and a molecular weight of 402.90 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-N-[2-(pyrrolidin-3-ylamino)ethyl]-1H-indole-2-carboxamide;hydron;chloride.
| Compound Name | 6-(4-fluorophenyl)-N-[2-(pyrrolidin-3-ylamino)ethyl]-1H-indole-2-carboxamide;hydron;chloride |
|---|---|
| PubChem CID | 135324452 |
| Molecular Formula | C21H24ClFN4O |
| Molecular Weight | 402.90 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | 6-(4-fluorophenyl)-N-[2-(pyrrolidin-3-ylamino)ethyl]-1H-indole-2-carboxamide;hydron;chloride |
| SMILES | O=C(NCCNC1CCNC1)c1cc2ccc(-c3ccc(F)cc3)cc2[nH]1.[Cl-].[H+] |
| InChI | InChI=1S/C21H23FN4O.ClH/c22-17-5-3-14(4-6-17)15-1-2-16-12-20(26-19(16)11-15)21(27)25-10-9-24-18-7-8-23-13-18;/h1-6,11-12,18,23-24,26H,7-10,13H2,(H,25,27);1H |
| InChIKey | WVPYSIJRKZNJOY-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 68.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.90 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|