C19H20ClFN3O+ — CID 156664162
[(3S)-3-chloro-4-[[6-(4-fluorophenyl)-1H-indole-2-carbonyl]amino]butyl]azanium (PubChem CID 156664162) has the molecular formula C19H20ClFN3O+ and a molecular weight of 360.84 g/mol. Its IUPAC name is [(3S)-3-chloro-4-[[6-(4-fluorophenyl)-1H-indole-2-carbonyl]amino]butyl]azanium.
| Compound Name | [(3S)-3-chloro-4-[[6-(4-fluorophenyl)-1H-indole-2-carbonyl]amino]butyl]azanium |
|---|---|
| PubChem CID | 156664162 |
| Molecular Formula | C19H20ClFN3O+ |
| Molecular Weight | 360.84 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | [(3S)-3-chloro-4-[[6-(4-fluorophenyl)-1H-indole-2-carbonyl]amino]butyl]azanium |
| SMILES | [NH3+]CC[C@H](Cl)CNC(=O)c1cc2ccc(-c3ccc(F)cc3)cc2[nH]1 |
| InChI | InChI=1S/C19H19ClFN3O/c20-15(7-8-22)11-23-19(25)18-10-14-2-1-13(9-17(14)24-18)12-3-5-16(21)6-4-12/h1-6,9-10,15,24H,7-8,11,22H2,(H,23,25)/p+1/t15-/m0/s1 |
| InChIKey | CLDNAYSVXQOSKB-HNNXBMFYSA-O |
| XLogP | 2.94 |
| TPSA | 72.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.84 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|