C21H25FN4O2 — CID 135324188
N-[(2S)-2,5-diaminopentyl]-6-(4-fluoro-3-methoxyphenyl)-1H-indole-2-carboxamide (PubChem CID 135324188) has the molecular formula C21H25FN4O2 and a molecular weight of 384.46 g/mol. Its IUPAC name is N-[(2S)-2,5-diaminopentyl]-6-(4-fluoro-3-methoxyphenyl)-1H-indole-2-carboxamide.
| Compound Name | N-[(2S)-2,5-diaminopentyl]-6-(4-fluoro-3-methoxyphenyl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 135324188 |
| Molecular Formula | C21H25FN4O2 |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | N-[(2S)-2,5-diaminopentyl]-6-(4-fluoro-3-methoxyphenyl)-1H-indole-2-carboxamide |
| SMILES | COc1cc(-c2ccc3cc(C(=O)NC[C@@H](N)CCCN)[nH]c3c2)ccc1F |
| InChI | InChI=1S/C21H25FN4O2/c1-28-20-11-14(6-7-17(20)22)13-4-5-15-10-19(26-18(15)9-13)21(27)25-12-16(24)3-2-8-23/h4-7,9-11,16,26H,2-3,8,12,23-24H2,1H3,(H,25,27)/t16-/m0/s1 |
| InChIKey | SZMGLIDITXXCEJ-INIZCTEOSA-N |
| XLogP | 2.78 |
| TPSA | 106.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |