C20H20F2N4O — CID 163740864
N-(5-amino-2-iminopentyl)-6-(3,4-difluorophenyl)-1H-indole-2-carboxamide (PubChem CID 163740864) has the molecular formula C20H20F2N4O and a molecular weight of 370.40 g/mol. Its IUPAC name is N-(5-amino-2-iminopentyl)-6-(3,4-difluorophenyl)-1H-indole-2-carboxamide.
| Compound Name | N-(5-amino-2-iminopentyl)-6-(3,4-difluorophenyl)-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 163740864 |
| Molecular Formula | C20H20F2N4O |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | N-(5-amino-2-iminopentyl)-6-(3,4-difluorophenyl)-1H-indole-2-carboxamide |
| SMILES | [H]/N=C(\CCCN)CNC(=O)c1cc2ccc(-c3ccc(F)c(F)c3)cc2[nH]1 |
| InChI | InChI=1S/C20H20F2N4O/c21-16-6-5-12(8-17(16)22)13-3-4-14-10-19(26-18(14)9-13)20(27)25-11-15(24)2-1-7-23/h3-6,8-10,24,26H,1-2,7,11,23H2,(H,25,27)/b24-15+ |
| InChIKey | LHOYQAFZVNSYIN-BUVRLJJBSA-N |
| XLogP | 3.60 |
| TPSA | 94.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|