C8H12N4O — CID 154843666
1-[(4-amino-2-pyridinyl)methyl]-3-methylurea (PubChem CID 154843666) has the molecular formula C8H12N4O and a molecular weight of 180.21 g/mol. Its IUPAC name is 1-[(4-amino-2-pyridinyl)methyl]-3-methylurea.
| Compound Name | 1-[(4-amino-2-pyridinyl)methyl]-3-methylurea |
|---|---|
| PubChem CID | 154843666 |
| Molecular Formula | C8H12N4O |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | 1-[(4-amino-2-pyridinyl)methyl]-3-methylurea |
| SMILES | CNC(=O)NCc1cc(N)ccn1 |
| InChI | InChI=1S/C8H12N4O/c1-10-8(13)12-5-7-4-6(9)2-3-11-7/h2-4H,5H2,1H3,(H2,9,11)(H2,10,12,13) |
| InChIKey | VWSKZJQSSWDFCS-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |