C32H36FN5O5 — CID 142426089
benzyl N-[(4R)-5-[[6-(4-fluorophenyl)-1H-benzimidazole-2-carbonyl]amino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl]carbamate (PubChem CID 142426089) has the molecular formula C32H36FN5O5 and a molecular weight of 589.67 g/mol. Its IUPAC name is benzyl N-[(4R)-5-[[6-(4-fluorophenyl)-1H-benzimidazole-2-carbonyl]amino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl]carbamate.
| Compound Name | benzyl N-[(4R)-5-[[6-(4-fluorophenyl)-1H-benzimidazole-2-carbonyl]amino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl]carbamate |
|---|---|
| PubChem CID | 142426089 |
| Molecular Formula | C32H36FN5O5 |
| Molecular Weight | 589.67 g/mol |
| Exact Mass | 589.27 |
| IUPAC Name | benzyl N-[(4R)-5-[[6-(4-fluorophenyl)-1H-benzimidazole-2-carbonyl]amino]-4-[(2-methylpropan-2-yl)oxycarbonylamino]pentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H](CCCNC(=O)OCc1ccccc1)CNC(=O)c1nc2ccc(-c3ccc(F)cc3)cc2[nH]1 |
| InChI | InChI=1S/C32H36FN5O5/c1-32(2,3)43-31(41)36-25(10-7-17-34-30(40)42-20-21-8-5-4-6-9-21)19-35-29(39)28-37-26-16-13-23(18-27(26)38-28)22-11-14-24(33)15-12-22/h4-6,8-9,11-16,18,25H,7,10,17,19-20H2,1-3H3,(H,34,40)(H,35,39)(H,36,41)(H,37,38)/t25-/m1/s1 |
| InChIKey | SWMPZDZUCKDNSE-RUZDIDTESA-N |
| XLogP | 5.70 |
| TPSA | 134.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.67 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|