C16H25ClN4O2 — CID 134540207
2-chloro-N-[(2S)-2-(diethylamino)propyl]-6-(propanoylamino)pyridine-4-carboxamide (PubChem CID 134540207) has the molecular formula C16H25ClN4O2 and a molecular weight of 340.86 g/mol. Its IUPAC name is 2-chloro-N-[(2S)-2-(diethylamino)propyl]-6-(propanoylamino)pyridine-4-carboxamide.
| Compound Name | 2-chloro-N-[(2S)-2-(diethylamino)propyl]-6-(propanoylamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 134540207 |
| Molecular Formula | C16H25ClN4O2 |
| Molecular Weight | 340.86 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | 2-chloro-N-[(2S)-2-(diethylamino)propyl]-6-(propanoylamino)pyridine-4-carboxamide |
| SMILES | CCC(=O)Nc1cc(C(=O)NC[C@H](C)N(CC)CC)cc(Cl)n1 |
| InChI | InChI=1S/C16H25ClN4O2/c1-5-15(22)20-14-9-12(8-13(17)19-14)16(23)18-10-11(4)21(6-2)7-3/h8-9,11H,5-7,10H2,1-4H3,(H,18,23)(H,19,20,22)/t11-/m0/s1 |
| InChIKey | HEQVCPVXMYFPML-NSHDSACASA-N |
| XLogP | 2.54 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.86 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|