C13H12Cl2N2OS — CID 61150801
2,6-dichloro-N-(1-thiophen-3-ylpropan-2-yl)pyridine-4-carboxamide (PubChem CID 61150801) has the molecular formula C13H12Cl2N2OS and a molecular weight of 315.23 g/mol. Its IUPAC name is 2,6-dichloro-N-(1-thiophen-3-ylpropan-2-yl)pyridine-4-carboxamide.
| Compound Name | 2,6-dichloro-N-(1-thiophen-3-ylpropan-2-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 61150801 |
| Molecular Formula | C13H12Cl2N2OS |
| Molecular Weight | 315.23 g/mol |
| Exact Mass | 314.00 |
| IUPAC Name | 2,6-dichloro-N-(1-thiophen-3-ylpropan-2-yl)pyridine-4-carboxamide |
| SMILES | CC(Cc1ccsc1)NC(=O)c1cc(Cl)nc(Cl)c1 |
| InChI | InChI=1S/C13H12Cl2N2OS/c1-8(4-9-2-3-19-7-9)16-13(18)10-5-11(14)17-12(15)6-10/h2-3,5-8H,4H2,1H3,(H,16,18) |
| InChIKey | CMHQUIRDWJVFHQ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.23 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|