C13H13BrN2OS — CID 103889839
6-bromo-N-(1-thiophen-3-ylpropan-2-yl)pyridine-2-carboxamide (PubChem CID 103889839) has the molecular formula C13H13BrN2OS and a molecular weight of 325.23 g/mol. Its IUPAC name is 6-bromo-N-(1-thiophen-3-ylpropan-2-yl)pyridine-2-carboxamide.
| Compound Name | 6-bromo-N-(1-thiophen-3-ylpropan-2-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 103889839 |
| Molecular Formula | C13H13BrN2OS |
| Molecular Weight | 325.23 g/mol |
| Exact Mass | 323.99 |
| IUPAC Name | 6-bromo-N-(1-thiophen-3-ylpropan-2-yl)pyridine-2-carboxamide |
| SMILES | CC(Cc1ccsc1)NC(=O)c1cccc(Br)n1 |
| InChI | InChI=1S/C13H13BrN2OS/c1-9(7-10-5-6-18-8-10)15-13(17)11-3-2-4-12(14)16-11/h2-6,8-9H,7H2,1H3,(H,15,17) |
| InChIKey | VCTUCTYAPFNRGD-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.23 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|