C12H14N2OS2 — CID 54952813
3-amino-N-(1-thiophen-3-ylpropan-2-yl)thiophene-2-carboxamide (PubChem CID 54952813) has the molecular formula C12H14N2OS2 and a molecular weight of 266.39 g/mol. Its IUPAC name is 3-amino-N-(1-thiophen-3-ylpropan-2-yl)thiophene-2-carboxamide.
| Compound Name | 3-amino-N-(1-thiophen-3-ylpropan-2-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 54952813 |
| Molecular Formula | C12H14N2OS2 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 3-amino-N-(1-thiophen-3-ylpropan-2-yl)thiophene-2-carboxamide |
| SMILES | CC(Cc1ccsc1)NC(=O)c1sccc1N |
| InChI | InChI=1S/C12H14N2OS2/c1-8(6-9-2-4-16-7-9)14-12(15)11-10(13)3-5-17-11/h2-5,7-8H,6,13H2,1H3,(H,14,15) |
| InChIKey | CZTCYCATTFIUBK-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |