C8H12N2S2 — CID 61473973
1-thiophen-3-ylpropan-2-ylthiourea (PubChem CID 61473973) has the molecular formula C8H12N2S2 and a molecular weight of 200.33 g/mol. Its IUPAC name is 1-thiophen-3-ylpropan-2-ylthiourea.
| Compound Name | 1-thiophen-3-ylpropan-2-ylthiourea |
|---|---|
| PubChem CID | 61473973 |
| Molecular Formula | C8H12N2S2 |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.04 |
| IUPAC Name | 1-thiophen-3-ylpropan-2-ylthiourea |
| SMILES | CC(Cc1ccsc1)NC(N)=S |
| InChI | InChI=1S/C8H12N2S2/c1-6(10-8(9)11)4-7-2-3-12-5-7/h2-3,5-6H,4H2,1H3,(H3,9,10,11) |
| InChIKey | SEJJSPCFXYVOAR-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|