C11H18N2S2 — CID 115590115
1-propyl-3-(1-thiophen-3-ylpropan-2-yl)thiourea (PubChem CID 115590115) has the molecular formula C11H18N2S2 and a molecular weight of 242.41 g/mol. Its IUPAC name is 1-propyl-3-(1-thiophen-3-ylpropan-2-yl)thiourea.
| Compound Name | 1-propyl-3-(1-thiophen-3-ylpropan-2-yl)thiourea |
|---|---|
| PubChem CID | 115590115 |
| Molecular Formula | C11H18N2S2 |
| Molecular Weight | 242.41 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 1-propyl-3-(1-thiophen-3-ylpropan-2-yl)thiourea |
| SMILES | CCCNC(=S)NC(C)Cc1ccsc1 |
| InChI | InChI=1S/C11H18N2S2/c1-3-5-12-11(14)13-9(2)7-10-4-6-15-8-10/h4,6,8-9H,3,5,7H2,1-2H3,(H2,12,13,14) |
| InChIKey | IKHQJBVGEDGRRT-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.41 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|