C7H7Cl2N5O — CID 88764448
2,6-dichloro-N-(diaminomethylideneamino)pyridine-4-carboxamide (PubChem CID 88764448) has the molecular formula C7H7Cl2N5O and a molecular weight of 248.07 g/mol. Its IUPAC name is 2,6-dichloro-N-(diaminomethylideneamino)pyridine-4-carboxamide.
| Compound Name | 2,6-dichloro-N-(diaminomethylideneamino)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 88764448 |
| Molecular Formula | C7H7Cl2N5O |
| Molecular Weight | 248.07 g/mol |
| Exact Mass | 247.00 |
| IUPAC Name | 2,6-dichloro-N-(diaminomethylideneamino)pyridine-4-carboxamide |
| SMILES | NC(N)=NNC(=O)c1cc(Cl)nc(Cl)c1 |
| InChI | InChI=1S/C7H7Cl2N5O/c8-4-1-3(2-5(9)12-4)6(15)13-14-7(10)11/h1-2H,(H,13,15)(H4,10,11,14) |
| InChIKey | MGJDSHGCOZXKQS-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 106.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.07 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|