C8H9ClN4O2 — CID 62156055
2-amino-N-(2-amino-2-oxoethyl)-6-chloropyridine-4-carboxamide (PubChem CID 62156055) has the molecular formula C8H9ClN4O2 and a molecular weight of 228.64 g/mol. Its IUPAC name is 2-amino-N-(2-amino-2-oxoethyl)-6-chloropyridine-4-carboxamide.
| Compound Name | 2-amino-N-(2-amino-2-oxoethyl)-6-chloropyridine-4-carboxamide |
|---|---|
| PubChem CID | 62156055 |
| Molecular Formula | C8H9ClN4O2 |
| Molecular Weight | 228.64 g/mol |
| Exact Mass | 228.04 |
| IUPAC Name | 2-amino-N-(2-amino-2-oxoethyl)-6-chloropyridine-4-carboxamide |
| SMILES | NC(=O)CNC(=O)c1cc(N)nc(Cl)c1 |
| InChI | InChI=1S/C8H9ClN4O2/c9-5-1-4(2-6(10)13-5)8(15)12-3-7(11)14/h1-2H,3H2,(H2,10,13)(H2,11,14)(H,12,15) |
| InChIKey | XVFSVIRYLRPFOY-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.64 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|