C10H12ClF2N3O2 — CID 103099339
2-amino-6-chloro-N-[2-(2,2-difluoroethoxy)ethyl]pyridine-4-carboxamide (PubChem CID 103099339) has the molecular formula C10H12ClF2N3O2 and a molecular weight of 279.67 g/mol. Its IUPAC name is 2-amino-6-chloro-N-[2-(2,2-difluoroethoxy)ethyl]pyridine-4-carboxamide.
| Compound Name | 2-amino-6-chloro-N-[2-(2,2-difluoroethoxy)ethyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 103099339 |
| Molecular Formula | C10H12ClF2N3O2 |
| Molecular Weight | 279.67 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | 2-amino-6-chloro-N-[2-(2,2-difluoroethoxy)ethyl]pyridine-4-carboxamide |
| SMILES | Nc1cc(C(=O)NCCOCC(F)F)cc(Cl)n1 |
| InChI | InChI=1S/C10H12ClF2N3O2/c11-7-3-6(4-9(14)16-7)10(17)15-1-2-18-5-8(12)13/h3-4,8H,1-2,5H2,(H2,14,16)(H,15,17) |
| InChIKey | ZGSFIPSXDFJEJH-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.67 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|