C9H12F2N4O2 — CID 114129297
6-amino-N-[2-(2,2-difluoroethoxy)ethyl]pyrazine-2-carboxamide (PubChem CID 114129297) has the molecular formula C9H12F2N4O2 and a molecular weight of 246.22 g/mol. Its IUPAC name is 6-amino-N-[2-(2,2-difluoroethoxy)ethyl]pyrazine-2-carboxamide.
| Compound Name | 6-amino-N-[2-(2,2-difluoroethoxy)ethyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 114129297 |
| Molecular Formula | C9H12F2N4O2 |
| Molecular Weight | 246.22 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 6-amino-N-[2-(2,2-difluoroethoxy)ethyl]pyrazine-2-carboxamide |
| SMILES | Nc1cncc(C(=O)NCCOCC(F)F)n1 |
| InChI | InChI=1S/C9H12F2N4O2/c10-7(11)5-17-2-1-14-9(16)6-3-13-4-8(12)15-6/h3-4,7H,1-2,5H2,(H2,12,15)(H,14,16) |
| InChIKey | SLERZALNZPBEEP-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.22 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|