C9H12ClN3O2S — CID 115631265
2-amino-6-chloro-N-(2-methylsulfinylethyl)pyridine-4-carboxamide (PubChem CID 115631265) has the molecular formula C9H12ClN3O2S and a molecular weight of 261.73 g/mol. Its IUPAC name is 2-amino-6-chloro-N-(2-methylsulfinylethyl)pyridine-4-carboxamide.
| Compound Name | 2-amino-6-chloro-N-(2-methylsulfinylethyl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 115631265 |
| Molecular Formula | C9H12ClN3O2S |
| Molecular Weight | 261.73 g/mol |
| Exact Mass | 261.03 |
| IUPAC Name | 2-amino-6-chloro-N-(2-methylsulfinylethyl)pyridine-4-carboxamide |
| SMILES | CS(=O)CCNC(=O)c1cc(N)nc(Cl)c1 |
| InChI | InChI=1S/C9H12ClN3O2S/c1-16(15)3-2-12-9(14)6-4-7(10)13-8(11)5-6/h4-5H,2-3H2,1H3,(H2,11,13)(H,12,14) |
| InChIKey | CBMQKEORIKIAQG-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.73 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|