C13H10ClF2N3O — CID 63373106
2-amino-6-chloro-N-[(2,5-difluorophenyl)methyl]pyridine-4-carboxamide (PubChem CID 63373106) has the molecular formula C13H10ClF2N3O and a molecular weight of 297.69 g/mol. Its IUPAC name is 2-amino-6-chloro-N-[(2,5-difluorophenyl)methyl]pyridine-4-carboxamide.
| Compound Name | 2-amino-6-chloro-N-[(2,5-difluorophenyl)methyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 63373106 |
| Molecular Formula | C13H10ClF2N3O |
| Molecular Weight | 297.69 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | 2-amino-6-chloro-N-[(2,5-difluorophenyl)methyl]pyridine-4-carboxamide |
| SMILES | Nc1cc(C(=O)NCc2cc(F)ccc2F)cc(Cl)n1 |
| InChI | InChI=1S/C13H10ClF2N3O/c14-11-4-7(5-12(17)19-11)13(20)18-6-8-3-9(15)1-2-10(8)16/h1-5H,6H2,(H2,17,19)(H,18,20) |
| InChIKey | NKRCCOGNTSTKDA-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.69 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|