C11H11F4NO4 — CID 22134602
2-amino-4-hydroxy-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid (PubChem CID 22134602) has the molecular formula C11H11F4NO4 and a molecular weight of 297.20 g/mol. Its IUPAC name is 2-amino-4-hydroxy-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid.
| Compound Name | 2-amino-4-hydroxy-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid |
|---|---|
| PubChem CID | 22134602 |
| Molecular Formula | C11H11F4NO4 |
| Molecular Weight | 297.20 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | 2-amino-4-hydroxy-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid |
| SMILES | NC(CC(O)COc1c(F)c(F)cc(F)c1F)C(=O)O |
| InChI | InChI=1S/C11H11F4NO4/c12-5-2-6(13)9(15)10(8(5)14)20-3-4(17)1-7(16)11(18)19/h2,4,7,17H,1,3,16H2,(H,18,19) |
| InChIKey | XMAMNGJUQKAFSE-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.20 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|