C10H8F5NO3 — CID 63033537
2-amino-4-(2,3,4,5,6-pentafluorophenoxy)butanoic acid (PubChem CID 63033537) has the molecular formula C10H8F5NO3 and a molecular weight of 285.17 g/mol. Its IUPAC name is 2-amino-4-(2,3,4,5,6-pentafluorophenoxy)butanoic acid.
| Compound Name | 2-amino-4-(2,3,4,5,6-pentafluorophenoxy)butanoic acid |
|---|---|
| PubChem CID | 63033537 |
| Molecular Formula | C10H8F5NO3 |
| Molecular Weight | 285.17 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | 2-amino-4-(2,3,4,5,6-pentafluorophenoxy)butanoic acid |
| SMILES | NC(CCOc1c(F)c(F)c(F)c(F)c1F)C(=O)O |
| InChI | InChI=1S/C10H8F5NO3/c11-4-5(12)7(14)9(8(15)6(4)13)19-2-1-3(16)10(17)18/h3H,1-2,16H2,(H,17,18) |
| InChIKey | JKCVZAFFEPQYBK-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.17 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|