C14H13F5O5 — CID 86614690
4-ethoxy-4-oxo-2-[2-(2,3,4,5,6-pentafluorophenoxy)ethyl]butanoic acid (PubChem CID 86614690) has the molecular formula C14H13F5O5 and a molecular weight of 356.24 g/mol. Its IUPAC name is 4-ethoxy-4-oxo-2-[2-(2,3,4,5,6-pentafluorophenoxy)ethyl]butanoic acid.
| Compound Name | 4-ethoxy-4-oxo-2-[2-(2,3,4,5,6-pentafluorophenoxy)ethyl]butanoic acid |
|---|---|
| PubChem CID | 86614690 |
| Molecular Formula | C14H13F5O5 |
| Molecular Weight | 356.24 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | 4-ethoxy-4-oxo-2-[2-(2,3,4,5,6-pentafluorophenoxy)ethyl]butanoic acid |
| SMILES | CCOC(=O)CC(CCOc1c(F)c(F)c(F)c(F)c1F)C(=O)O |
| InChI | InChI=1S/C14H13F5O5/c1-2-23-7(20)5-6(14(21)22)3-4-24-13-11(18)9(16)8(15)10(17)12(13)19/h6H,2-5H2,1H3,(H,21,22) |
| InChIKey | XZGCYQIYWNPZEE-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.24 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|