C6H9NO6 — CID 46173773
(2S)-2-amino-4-oxalooxybutanoic acid (PubChem CID 46173773) has the molecular formula C6H9NO6 and a molecular weight of 191.14 g/mol. Its IUPAC name is (2S)-2-amino-4-oxalooxybutanoic acid.
| Compound Name | (2S)-2-amino-4-oxalooxybutanoic acid |
|---|---|
| PubChem CID | 46173773 |
| Molecular Formula | C6H9NO6 |
| Molecular Weight | 191.14 g/mol |
| Exact Mass | 191.04 |
| IUPAC Name | (2S)-2-amino-4-oxalooxybutanoic acid |
| SMILES | N[C@@H](CCOC(=O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C6H9NO6/c7-3(4(8)9)1-2-13-6(12)5(10)11/h3H,1-2,7H2,(H,8,9)(H,10,11)/t3-/m0/s1 |
| InChIKey | VKKDEHWBBKSWQQ-VKHMYHEASA-N |
| XLogP | -1.58 |
| TPSA | 126.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.14 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|