C10H24N8O6 — CID 22376237
2-amino-4-(diaminomethylideneamino)oxybutanoic acid (PubChem CID 22376237) has the molecular formula C10H24N8O6 and a molecular weight of 352.35 g/mol. Its IUPAC name is 2-amino-4-(diaminomethylideneamino)oxybutanoic acid.
| Compound Name | 2-amino-4-(diaminomethylideneamino)oxybutanoic acid |
|---|---|
| PubChem CID | 22376237 |
| Molecular Formula | C10H24N8O6 |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 2-amino-4-(diaminomethylideneamino)oxybutanoic acid |
| SMILES | NC(N)=NOCCC(N)C(=O)O.NC(N)=NOCCC(N)C(=O)O |
| InChI | InChI=1S/2C5H12N4O3/c2*6-3(4(10)11)1-2-12-9-5(7)8/h2*3H,1-2,6H2,(H,10,11)(H4,7,8,9) |
| InChIKey | GAXUGXBVIWSLLF-UHFFFAOYSA-N |
| XLogP | -4.01 |
| TPSA | 273.90 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | -4.01 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|