C9H21N5O6 — CID 174277232
2-amino-4-(1-aminoethylideneamino)oxybutanoic acid;2-amino-N,3-dihydroxypropanamide (PubChem CID 174277232) has the molecular formula C9H21N5O6 and a molecular weight of 295.30 g/mol. Its IUPAC name is 2-amino-4-(1-aminoethylideneamino)oxybutanoic acid;2-amino-N,3-dihydroxypropanamide.
| Compound Name | 2-amino-4-(1-aminoethylideneamino)oxybutanoic acid;2-amino-N,3-dihydroxypropanamide |
|---|---|
| PubChem CID | 174277232 |
| Molecular Formula | C9H21N5O6 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | 2-amino-4-(1-aminoethylideneamino)oxybutanoic acid;2-amino-N,3-dihydroxypropanamide |
| SMILES | CC(N)=NOCCC(N)C(=O)O.NC(CO)C(=O)NO |
| InChI | InChI=1S/C6H13N3O3.C3H8N2O3/c1-4(7)9-12-3-2-5(8)6(10)11;4-2(1-6)3(7)5-8/h5H,2-3,8H2,1H3,(H2,7,9)(H,10,11);2,6,8H,1,4H2,(H,5,7) |
| InChIKey | QFIRPEJGKWQZBO-UHFFFAOYSA-N |
| XLogP | -3.09 |
| TPSA | 206.51 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | -3.09 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|