C5H11N3O3S — CID 11745499
(2S)-2-amino-4-(carbamothioylamino)oxybutanoic acid (PubChem CID 11745499) has the molecular formula C5H11N3O3S and a molecular weight of 193.23 g/mol. Its IUPAC name is (2S)-2-amino-4-(carbamothioylamino)oxybutanoic acid.
| Compound Name | (2S)-2-amino-4-(carbamothioylamino)oxybutanoic acid |
|---|---|
| PubChem CID | 11745499 |
| Molecular Formula | C5H11N3O3S |
| Molecular Weight | 193.23 g/mol |
| Exact Mass | 193.05 |
| IUPAC Name | (2S)-2-amino-4-(carbamothioylamino)oxybutanoic acid |
| SMILES | NC(=S)NOCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C5H11N3O3S/c6-3(4(9)10)1-2-11-8-5(7)12/h3H,1-2,6H2,(H,9,10)(H3,7,8,12)/t3-/m0/s1 |
| InChIKey | OSDFJLRFXAJROA-VKHMYHEASA-N |
| XLogP | -1.45 |
| TPSA | 110.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.23 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|