C8H14N2O7 — CID 159876263
(2S)-2,5-diamino-5-oxopentanoic acid;propanedioic acid (PubChem CID 159876263) has the molecular formula C8H14N2O7 and a molecular weight of 250.21 g/mol. Its IUPAC name is (2S)-2,5-diamino-5-oxopentanoic acid;propanedioic acid.
| Compound Name | (2S)-2,5-diamino-5-oxopentanoic acid;propanedioic acid |
|---|---|
| PubChem CID | 159876263 |
| Molecular Formula | C8H14N2O7 |
| Molecular Weight | 250.21 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | (2S)-2,5-diamino-5-oxopentanoic acid;propanedioic acid |
| SMILES | NC(=O)CC[C@H](N)C(=O)O.O=C(O)CC(=O)O |
| InChI | InChI=1S/C5H10N2O3.C3H4O4/c6-3(5(9)10)1-2-4(7)8;4-2(5)1-3(6)7/h3H,1-2,6H2,(H2,7,8)(H,9,10);1H2,(H,4,5)(H,6,7)/t3-;/m0./s1 |
| InChIKey | NSYDDTSUXNLUFT-DFWYDOINSA-N |
| XLogP | -1.79 |
| TPSA | 181.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.21 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|